Systematic / IUPAC Name: 1-Phenyl-2-propanamine
ID: Reference681
Other Names:
(S)-1-Phenyl-2-propylamine;
(+)-α-Methylphenylethylamine;
(+)-α-Methylphenethylamine;
D-α-Methylphenethylamine;
(S)-α-Methylphenethylamine
; more
Formula: C9H13N
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs
D-Amphetamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 190 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/27/2016 8:50:17 AM |
| InChI | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m0/s1 |
| InChI Key | KWTSXDURSIMDCE-QMMMGPOBSA-N |
| Canonical SMILES | CC(CC1=CC=CC=C1)N |
| CAS | 51649 |
| Splash | |
| Other Names |
(S)-1-Phenyl-2-propylamine; (+)-α-Methylphenylethylamine; (+)-α-Methylphenethylamine; D-α-Methylphenethylamine; (S)-α-Methylphenethylamine; Benzeneethanamine, α-methyl, (S)-; Phenethylamine, α-methyl, D-; D-Amphetamine; Dexamfetamine; (S)-Amphetamine; Dexedrine; (+)-Amphetamine; (+)-(S)-Amphetamine; Dexadrine; Desamfetamina; Dexidrine; Sympamin; D-(+)-Amphetamine; Benzedrine; Propisamine; Raphetamine; Rhinalator; Simpatedrin; Sympatedrine; Isoamycin; Sympamine; Weckamine; Norephedrane; Phenedrine; Actedron; Allodene; Anorexide; Anorexine; Benzebar; Benzolone; Elastonon; Isoamyne; Mecodrin; Novydrine; Oktedrin; Ortedrine; Percomon; Phenamine; Profamina; Simpatina; Adipan; Isomyn; Finam; Psychedrine |
| DrugBank | APRD00480 |
| ChEMBL | CHEMBL612 |
| ChemSpider | 5621 |
| KEGG | C07884; D03740 |
| Wikipedia | Dextroamphetamine; Amphetamine |
| HMDb | HMDB15516 |
| ChemIDPlus | 000051649 |
| ChEBI | CHEBI:4469 |
| PubChem | 5826 |