Systematic / IUPAC Name: (2E)-4-(Abieta-8,11,13-trien-18-ylamino)-4-oxo-2-butenoic acid
ID: Reference6812
Other Names: 2-Butenoic acid, 4-({[1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-1-phenanthrenyl]methyl}amino)-4-oxo-, (2E)-
Formula: C24H33NO3
4-{[(7-Isopropyl-1,4a-dimethyl-1,2,3,4,4a,9,10,10a-octahydrophenanthren-1-yl)methyl]amino}-4-oxobut-2-enoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2017 11:13:33 AM |
| InChI | InChI=1S/C24H33NO3/c1-16(2)17-6-8-19-18(14-17)7-9-20-23(3,12-5-13-24(19,20)4)15-25-21(26)10-11-22(27)28/h6,8,10-11,14,16,20H,5,7,9,12-13,15H2,1-4H3,(H,25,26)(H,27,28)/b11-10+ |
| InChI Key | FOVDKVLUIXQBIW-ZHACJKMWSA-N |
| Canonical SMILES | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2)(C)CNC(=O)C=CC(=O)O)C |
| CAS | |
| Splash | |
| Other Names | 2-Butenoic acid, 4-({[1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-1-phenanthrenyl]methyl}amino)-4-oxo-, (2E)- |