Systematic / IUPAC Name: S-Benzyl-N-(4-nitrophenyl)cysteinamide
ID: Reference6817
Other Names:
2-Amino-3-(benzylsulfanyl)-N-(4-nitrophenyl)propanamide;
Propanamide, 2-amino-N-(4-nitrophenyl)-3-[(phenylmethyl)thio]-
Formula: C16H17N3O3S
N1-(4-Nitrophenyl)-2-amino-3-(benzylthio)propanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 236 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/13/2017 1:01:13 PM |
| InChI | InChI=1S/C16H17N3O3S/c17-15(11-23-10-12-4-2-1-3-5-12)16(20)18-13-6-8-14(9-7-13)19(21)22/h1-9,15H,10-11,17H2,(H,18,20) |
| InChI Key | HOZQMLJHNCMSRC-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
2-Amino-3-(benzylsulfanyl)-N-(4-nitrophenyl)propanamide; Propanamide, 2-amino-N-(4-nitrophenyl)-3-[(phenylmethyl)thio]- |
| ChEMBL | CHEMBL1864463 |
| PubChem | 100118 |
| ChemIDPlus | 052207075 |
| ChemSpider | 90474 |