Systematic / IUPAC Name: 3,5a,9-Trimethyl-3a,5,5a,9b-tetrahydronaphtho[1,2-b]furan-2,8(3H,4H)-dione
ID: Reference6818
Other Names: Naphtho[1,2-b]furan-2,8(3H,4H)-dione, 3a,5,5a,9b-tetrahydro-3,5a,9-trimethyl-
Formula: C15H18O3
3,5a,9-Trimethyl-2,3,3a,4,5,5a,8,9b-octahydronaphtho[1,2-b]furan-2,8-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/13/2017 1:04:17 PM |
| InChI | InChI=1S/C15H18O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h5,7-8,10,13H,4,6H2,1-3H3 |
| InChI Key | XJHDMGJURBVLLE-UHFFFAOYSA-N |
| Canonical SMILES | CC1C2CCC3(C=CC(=O)C(=C3C2OC1=O)C)C |
| CAS | |
| Splash | |
| Other Names | Naphtho[1,2-b]furan-2,8(3H,4H)-dione, 3a,5,5a,9b-tetrahydro-3,5a,9-trimethyl- |
| ChemIDPlus | 001618786; 000481072 |
| PubChem | 5156 |
| ChEMBL | CHEMBL226231 |
| ChemSpider | 4972 |