Systematic / IUPAC Name: 1-(4-Chlorophenyl)-3-[4-methyl-2-(2-thienyl)-1,3-thiazol-5-yl]urea
ID: Reference6847
Other Names:
1-(4-Chlorophenyl)-3-[4-methyl-2-(thiophen-2-yl)-1,3-thiazol-5-yl]urea;
Urea, N-(4-chlorophenyl)-N'-[4-methyl-2-(2-thienyl)-5-thiazolyl]-
Formula: C15H12ClN3OS2
1-(4-Chlorophenyl)-3-[4-methyl-2-(2-thienyl)-1,3-thiazol-5-yl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/21/2017 8:48:39 AM |
| InChI | InChI=1S/C15H12ClN3OS2/c1-9-13(22-14(17-9)12-3-2-8-21-12)19-15(20)18-11-6-4-10(16)5-7-11/h2-8H,1H3,(H2,18,19,20) |
| InChI Key | SAOMAGDAEMIKQP-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC(=N1)C2=CC=CS2)NC(=O)NC3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names |
1-(4-Chlorophenyl)-3-[4-methyl-2-(thiophen-2-yl)-1,3-thiazol-5-yl]urea; Urea, N-(4-chlorophenyl)-N'-[4-methyl-2-(2-thienyl)-5-thiazolyl]- |
| ChemSpider | 2025544 |
| PubChem | 2744041 |
| ChEBI | CHEBI:64127 |