Systematic / IUPAC Name: 2-[(4-Amino-1,3,5-triazin-2-yl)sulfanyl]-N-(4-isopropylphenyl)acetamide
ID: Reference6849
Other Names: Acetamide, 2-[(4-amino-1,3,5-triazin-2-yl)thio]-N-[4-(1-methylethyl)phenyl]-
Formula: C14H17N5OS
N1-(4-Isopropylphenyl)-2-[(4-amino-1,3,5-triazin-2-yl)thio]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 275 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/21/2017 8:51:38 AM |
| InChI | InChI=1S/C14H17N5OS/c1-9(2)10-3-5-11(6-4-10)18-12(20)7-21-14-17-8-16-13(15)19-14/h3-6,8-9H,7H2,1-2H3,(H,18,20)(H2,15,16,17,19) |
| InChI Key | KHZKQWYOPVDONN-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C1=CC=C(C=C1)NC(=O)CSC2=NC=NC(=N2)N |
| CAS | |
| Splash | |
| Other Names | Acetamide, 2-[(4-amino-1,3,5-triazin-2-yl)thio]-N-[4-(1-methylethyl)phenyl]- |