Systematic / IUPAC Name: N-(4-Isopropylphenyl)-2-{[4-(2'-methyl-2,4'-bi-1,3-thiazol-4-yl)-2-pyrimidinyl]sulfanyl}acetamide
ID: Reference6857
Other Names: Acetamide, 2-({4-[2'-methyl(2,4'-bithiazol)-4-yl]-2-pyrimidinyl}thio)-N-[4-(1-methylethyl)phenyl]-
Formula: C22H21N5OS3
N-(4-Isopropylphenyl)-2-({4-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]pyrimidin-2-yl}thio)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/22/2017 12:38:53 PM |
| InChI | InChI=1S/C22H21N5OS3/c1-13(2)15-4-6-16(7-5-15)25-20(28)12-31-22-23-9-8-17(27-22)18-10-30-21(26-18)19-11-29-14(3)24-19/h4-11,13H,12H2,1-3H3,(H,25,28) |
| InChI Key | IFMDZGFAUPAEQX-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NC(=CS1)C2=NC(=CS2)C3=NC(=NC=C3)SCC(=O)NC4=CC=C(C=C4)C(C)C |
| CAS | |
| Splash | |
| Other Names | Acetamide, 2-({4-[2'-methyl(2,4'-bithiazol)-4-yl]-2-pyrimidinyl}thio)-N-[4-(1-methylethyl)phenyl]- |