Systematic / IUPAC Name: 6-[(2-Chlorophenyl)amino]-2-{[4-(2-methyl-2-propanyl)phenoxy]methyl}-4(1H)-pyrimidinone
ID: Reference6860
Other Names:
(4E)-2-[(4-tert-Butylphenoxy)methyl]-4-(2-chlorophenyl)imino-1H-pyrimidin-6-ol ;
4(1H)-Pyrimidinone, 6-[(2-chlorophenyl)amino]-2-{[4-(1,1-dimethylethyl)phenoxy]methyl}-
Formula: C21H22ClN3O2
2-{[4-(tert-Butyl)phenoxy]methyl}-6-[(2-chlorophenyl)imino]-3,6-dihydropyrimidin-4-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/25/2017 9:15:12 AM |
| InChI | InChI=1S/C21H22ClN3O2/c1-21(2,3)14-8-10-15(11-9-14)27-13-19-24-18(12-20(26)25-19)23-17-7-5-4-6-16(17)22/h4-12H,13H2,1-3H3,(H2,23,24,25,26) |
| InChI Key | RKVMQPKSSYXHJR-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)C1=CC=C(C=C1)OCC2=NC(=O)C=C(N2)NC3=CC=CC=C3Cl |
| CAS | |
| Splash | |
| Other Names |
(4E)-2-[(4-tert-Butylphenoxy)methyl]-4-(2-chlorophenyl)imino-1H-pyrimidin-6-ol ; 4(1H)-Pyrimidinone, 6-[(2-chlorophenyl)amino]-2-{[4-(1,1-dimethylethyl)phenoxy]methyl}- |