Systematic / IUPAC Name: Ethyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)hydrazinecarboxylate
ID: Reference6867
Other Names: Hydrazinecarboxylic acid, 2-{[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]thioxomethyl}-, ethyl ester
Formula: C12H15N3O4S
Ethyl 2-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)carbothioyl]-1-hydrazinecarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/26/2017 10:11:22 AM |
| InChI | InChI=1S/C12H15N3O4S/c1-2-17-12(16)15-14-11(20)13-8-3-4-9-10(7-8)19-6-5-18-9/h3-4,7H,2,5-6H2,1H3,(H,15,16)(H2,13,14,20) |
| InChI Key | IPIBPGGPPDWCGT-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)NNC(=S)NC1=CC2=C(C=C1)OCCO2 |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarboxylic acid, 2-{[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]thioxomethyl}-, ethyl ester |