Systematic / IUPAC Name: Methyl N-{[1-(4-fluorobenzyl)-1H-indol-3-yl]carbonyl}-3-methyl-L-valinate
ID: Reference6882
Other Names: L-Valine, N-({1-[(4-fluorophenyl)methyl]-1H-indol-3-yl}carbonyl)-3-methyl, methyl ester
Formula: C23H25FN2O3
MDMB-FUBICA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/2/2017 12:51:27 PM |
| InChI | InChI=1S/C23H25FN2O3/c1-23(2,3)20(22(28)29-4)25-21(27)18-14-26(19-8-6-5-7-17(18)19)13-15-9-11-16(24)12-10-15/h5-12,14,20H,13H2,1-4H3,(H,25,27)/t20-/m1/s1 |
| InChI Key | RVAWIZIGOSKPBP-HXUWFJFHSA-N |
| Canonical SMILES | CC(C)(C)C(C(=O)OC)NC(=O)C1=CN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
| CAS | 1971007916 |
| Splash | |
| Other Names | L-Valine, N-({1-[(4-fluorophenyl)methyl]-1H-indol-3-yl}carbonyl)-3-methyl, methyl ester |
| PubChem | 129522107 |
| ChemSpider | 57621561 |
| Wikipedia | MDMB-FUBICA |