Systematic / IUPAC Name: 1-(4-Fluorobenzyl)-1H-indole-3-carboxylic acid
ID: Reference6898
Other Names:
1-[(4-Fluorophenyl)methyl]indole-3-carboxylic acid;
1H-Indole-3-carboxylic acid, 1-[(4-fluorophenyl)methyl]-
Formula: C16H12FNO2
FUB-PB-22 3-carboxyindole metabolite mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 218 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/9/2017 7:11:24 AM |
| InChI | InChI=1S/C16H12FNO2/c17-12-7-5-11(6-8-12)9-18-10-14(16(19)20)13-3-1-2-4-15(13)18/h1-8,10H,9H2,(H,19,20) |
| InChI Key | MRLLPLNNVZERDA-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)F)C(=O)O |
| CAS | 226883790 |
| Splash | |
| Other Names |
1-[(4-Fluorophenyl)methyl]indole-3-carboxylic acid; 1H-Indole-3-carboxylic acid, 1-[(4-fluorophenyl)methyl]- |