Systematic / IUPAC Name: 3,4-Dichloro-N-{[1-(4-methyl-1-piperazinyl)cyclohexyl]methyl}benzamide
ID: Reference6906
Other Names: Benzamide, 3,4-dichloro-N-{[1-(4-methyl-1-piperazinyl)cyclohexyl]methyl}-
Formula: C19H27Cl2N3O
AH 8507 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 188 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/12/2017 6:56:55 AM |
| InChI | InChI=1S/C19H27Cl2N3O/c1-23-9-11-24(12-10-23)19(7-3-2-4-8-19)14-22-18(25)15-5-6-16(20)17(21)13-15/h5-6,13H,2-4,7-12,14H2,1H3,(H,22,25) |
| InChI Key | RIVJZGXJJBBWIJ-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCN(CC1)C2(CCCCC2)CNC(=O)C3=CC(=C(C=C3)Cl)Cl |
| CAS | 41805634 |
| Splash | |
| Other Names | Benzamide, 3,4-dichloro-N-{[1-(4-methyl-1-piperazinyl)cyclohexyl]methyl}- |