Systematic / IUPAC Name: N-(1-Amino-3,3-dimethyl-1-oxo-2-butanyl)-1-benzyl-1H-indole-3-carboxamide
ID: Reference6912
Other Names: 1H-Indole-3-carboxamide, N-[1-(aminocarbonyl)-2,2-dimethylpropyl]-1-(phenylmethyl)-
Formula: C22H25N3O2
ADB-BICA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/13/2017 9:33:01 AM |
| InChI | InChI=1S/C22H25N3O2/c1-22(2,3)19(20(23)26)24-21(27)17-14-25(13-15-9-5-4-6-10-15)18-12-8-7-11-16(17)18/h4-12,14,19H,13H2,1-3H3,(H2,23,26)(H,24,27) |
| InChI Key | OGVITAUBEIIKNT-UHFFFAOYSA-N |
| Canonical SMILES | O=C(NC(C(N)=O)C(C)(C)C)C1=CN(CC2=CC=CC=C2)C3=C1C=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 1H-Indole-3-carboxamide, N-[1-(aminocarbonyl)-2,2-dimethylpropyl]-1-(phenylmethyl)- |
| ChemSpider | 57621589 |