Systematic / IUPAC Name: [1-(5-Fluoropentyl)indol-3-yl]-(4-methylnaphthalen-1-yl)methanone
ID: Reference6913
Other Names:
[1-(5-Fluoropentyl)-1H-indol-3-yl](4-methylnaphthalen-1-yl)methanone ;
4-Methyl AM-2201;
Methanone, [1-(5-fluoropentyl)-1H-indol-3-yl](4-methyl-1-naphthalenyl)-;
AM2201 4-methylnaphthyl analog ;
JWH 122 N-(5-fluoropentyl) analog
Formula: C25H24FNO
MAM-2201 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/13/2017 9:41:59 AM |
| InChI | InChI=1S/C25H24FNO/c1-18-13-14-22(20-10-4-3-9-19(18)20)25(28)23-17-27(16-8-2-7-15-26)24-12-6-5-11-21(23)24/h3-6,9-14,17H,2,7-8,15-16H2,1H3 |
| InChI Key | IGBHZHCGWLHBAE-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C2=CC=CC=C12)C(=O)C3=CN(C4=CC=CC=C43)CCCCCF |
| CAS | 1354631245 |
| Splash | |
| Other Names |
[1-(5-Fluoropentyl)-1H-indol-3-yl](4-methylnaphthalen-1-yl)methanone ; 4-Methyl AM-2201; Methanone, [1-(5-fluoropentyl)-1H-indol-3-yl](4-methyl-1-naphthalenyl)-; AM2201 4-methylnaphthyl analog ; JWH 122 N-(5-fluoropentyl) analog |