Systematic / IUPAC Name: (2,4-Dichlorophenyl){5-[5-(2,4-difluorophenyl)-2-furyl]-1H-pyrazol-1-yl}methanone
ID: Reference6925
Other Names:
(2,4-Dichlorophenyl)-{5-[5-(2,4-difluorophenyl)furan-2-yl]pyrazol-1-yl}methanone ;
Methanone, (2,4-dichlorophenyl){5-[5-(2,4-difluorophenyl)-2-furanyl]-1H-pyrazol-1-yl}-
Formula: C20H10Cl2F2N2O2
(2,4-Dichlorophenyl){5-[5-(2,4-difluorophenyl)-2-furyl]-1H-pyrazol-1-yl}methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2017 7:32:02 AM |
| InChI | InChI=1S/C20H10Cl2F2N2O2/c21-11-1-3-13(15(22)9-11)20(27)26-17(7-8-25-26)19-6-5-18(28-19)14-4-2-12(23)10-16(14)24/h1-10H |
| InChI Key | TZVZCGFXLUXWGY-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1F)F)C2=CC=C(O2)C3=CC=NN3C(=O)C4=C(C=C(C=C4)Cl)Cl |
| CAS | |
| Splash | |
| Other Names |
(2,4-Dichlorophenyl)-{5-[5-(2,4-difluorophenyl)furan-2-yl]pyrazol-1-yl}methanone ; Methanone, (2,4-dichlorophenyl){5-[5-(2,4-difluorophenyl)-2-furanyl]-1H-pyrazol-1-yl}- |