Systematic / IUPAC Name: N,N-Diethyl-5-(2-methyl-1,3-thiazol-4-yl)-2-thiophenesulfonamide
ID: Reference6926
Other Names: 2-Thiophenesulfonamide, N,N-diethyl-5-(2-methyl-4-thiazolyl)-
Formula: C12H16N2O2S3
N2,N2-Diethyl-5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2017 7:09:28 AM |
| InChI | InChI=1S/C12H16N2O2S3/c1-4-14(5-2)19(15,16)12-7-6-11(18-12)10-8-17-9(3)13-10/h6-8H,4-5H2,1-3H3 |
| InChI Key | HVRFPORBSGWKPR-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)S(=O)(=O)C1=CC=C(S1)C2=CSC(=N2)C |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenesulfonamide, N,N-diethyl-5-(2-methyl-4-thiazolyl)- |
| ChemSpider | 2074458 |
| ChEMBL | CHEMBL1402128 |
| PubChem | 2795581 |