Systematic / IUPAC Name: Methyl 2-{(E)-[(hydroxyamino)methylene]amino}benzoate
ID: Reference6933
Other Names:
Benzoic acid 2-{[(hydroxyamino)methylene]amino}-,methyl ester ;
Methyl 2-{[(hydroxyamino)methylene]amino}benzoate
Formula: C9H10N2O3
Methyl 2-[(hydroxyiminomethyl)amino]benzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2017 12:43:48 PM |
| InChI | InChI=1S/C9H10N2O3/c1-14-9(12)7-4-2-3-5-8(7)10-6-11-13/h2-6,13H,1H3,(H,10,11) |
| InChI Key | BHQDJWWRSBFBNM-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=CC=CC=C1N=CNO |
| CAS | |
| Splash | |
| Other Names |
Benzoic acid 2-{[(hydroxyamino)methylene]amino}-,methyl ester ; Methyl 2-{[(hydroxyamino)methylene]amino}benzoate |