Systematic / IUPAC Name: Diethyl 2-[(4-fluoroanilino)methylidene]propanedioate
ID: Reference6934
Other Names:
(4-Fluorophenylamino)methylenemalonic acid diethyl ester;
1,3-Diethyl 2-{[(4-fluorophenyl)amino]methylidene}propanedioate;
2-[(4-Fluoro-phenylamino)-methylene]-malonic acid diethyl ester;
4-Fluoroanilinomethylenemalonic acid, diethyl ester;
Diethyl {[(4-fluorophenyl)amino]methylene}malonate
; more
Formula: C14H16FNO4
Diethyl 2-[(4-fluoroanilino)methylidene]malonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2017 12:41:22 PM |
| InChI | InChI=1S/C14H16FNO4/c1-3-19-13(17)12(14(18)20-4-2)9-16-11-7-5-10(15)6-8-11/h5-9,16H,3-4H2,1-2H3 |
| InChI Key | UKOQPGUZNBTTLG-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(=CNC1=CC=C(C=C1)F)C(=O)OCC |
| CAS | 26832962 |
| Splash | |
| Other Names |
(4-Fluorophenylamino)methylenemalonic acid diethyl ester; 1,3-Diethyl 2-{[(4-fluorophenyl)amino]methylidene}propanedioate; 2-[(4-Fluoro-phenylamino)-methylene]-malonic acid diethyl ester; 4-Fluoroanilinomethylenemalonic acid, diethyl ester; Diethyl {[(4-fluorophenyl)amino]methylene}malonate; Diethyl {[(4-fluorophenyl)amino]methylidene}propanedioate; Diethyl 2-(((4-fluorophenyl)amino)methylene)malonate; Diethyl 2-((4-fluorophenylamino)methylene)malonate; Diethyl 2-[(4-fluoroanilino)methylene]malonate; Propanedioic acid,2-[[(4-fluorophenyl)amino]methylene]-, 1,3-diethyl ester |