Systematic / IUPAC Name: N'-Hydroxy-4-phenylmethoxybenzenecarboximidamide
ID: Reference6936
Other Names:
(Hydroxyimino)[4-(phenylmethoxy)phenyl]methylamine;
4-(Benzyloxy)-N'-hydroxybenzenecarboximidamide ;
Benzenecarboximidamide, N'-hydroxy-4-(phenylmethoxy)-
Formula: C14H14N2O2
4-(Benzyloxy)-N'-hydroxybenzenecarboximidamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2017 2:38:40 PM |
| InChI | InChI=1S/C14H14N2O2/c15-14(16-17)12-6-8-13(9-7-12)18-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H2,15,16) |
| InChI Key | QBOOJKVECPVATQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(=NO)N |
| CAS | |
| Splash | |
| Other Names |
(Hydroxyimino)[4-(phenylmethoxy)phenyl]methylamine; 4-(Benzyloxy)-N'-hydroxybenzenecarboximidamide ; Benzenecarboximidamide, N'-hydroxy-4-(phenylmethoxy)- |