Systematic / IUPAC Name: N-[3,5-Bis(trifluoromethyl)phenyl]-5-(2-phenoxy-3-pyridinyl)-1,3,4-thiadiazol-2-amine
ID: Reference6943
Other Names: 1,3,4-Thiadiazol-2-amine, N-[3,5-bis(trifluoromethyl)phenyl]-5-(2-phenoxy-3-pyridinyl)-
Formula: C21H12F6N4OS
N2-[3,5-Bis(trifluoromethyl)phenyl]-5-(2-phenoxy-3-pyridyl)-1,3,4-thiadiazol-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/20/2017 6:05:22 AM |
| InChI | InChI=1S/C21H12F6N4OS/c22-20(23,24)12-9-13(21(25,26)27)11-14(10-12)29-19-31-30-18(33-19)16-7-4-8-28-17(16)32-15-5-2-1-3-6-15/h1-11H,(H,29,31) |
| InChI Key | GXBAHPWGRHWJEJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC2=C(C=CC=N2)C3=NN=C(S3)NC4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 1,3,4-Thiadiazol-2-amine, N-[3,5-bis(trifluoromethyl)phenyl]-5-(2-phenoxy-3-pyridinyl)- |