Systematic / IUPAC Name: Dimethyl 1,4-cyclohexanedicarboxylate
ID: Reference695
Other Names:
Dimethyl cyclohexane-1,4-dicarboxylate;
Dimethyl hexahydroterephthalate;
1,4-Cyclohexanedicarboxylic acid, 1,4-dimethyl ester
Formula: C10H16O4
Dimethyl cyclohexane-1,4-dicarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/23/2015 3:57:56 PM |
| InChI | InChI=1S/C10H16O4/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2/h7-8H,3-6H2,1-2H3 |
| InChI Key | LNGAGQAGYITKCW-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1CCC(CC1)C(=O)OC |
| CAS | 94600 |
| Splash | |
| Other Names |
Dimethyl cyclohexane-1,4-dicarboxylate; Dimethyl hexahydroterephthalate; 1,4-Cyclohexanedicarboxylic acid, 1,4-dimethyl ester |
| PubChem | 7198 |
| ChemSpider | 6930 |
| ChEMBL | CHEMBL1894902 |
| ChemIDPlus | 000094600; 003399222 |