Systematic / IUPAC Name: [3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]{2-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazolidin-3-yl}methanone
ID: Reference6950
Other Names: Methanone, [3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl][2-[(4-methyl-2-nitrophenoxy)methyl]-3-thiazolidinyl]-
Formula: C22H19Cl2N3O5S
[3-(2,6-Dichlorophenyl)-5-methylisoxazol-4-yl]{2-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazolan-3-yl}methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/23/2017 8:14:48 AM |
| InChI | InChI=1S/C22H19Cl2N3O5S/c1-12-6-7-17(16(10-12)27(29)30)31-11-18-26(8-9-33-18)22(28)19-13(2)32-25-21(19)20-14(23)4-3-5-15(20)24/h3-7,10,18H,8-9,11H2,1-2H3 |
| InChI Key | CFZFUZNYHYHBBJ-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Methanone, [3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolyl][2-[(4-methyl-2-nitrophenoxy)methyl]-3-thiazolidinyl]- |