Systematic / IUPAC Name: 3-Methyl-1-phenyl-1H-pyrazol-5-yl benzoate
ID: Reference6953
Other Names: Benzoic acid 5-methyl-2-phenyl-2H-pyrazol-3-yl ester
Formula: C17H14N2O2
3-Methyl-1-phenyl-1H-5-pyrazolyl benzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/23/2017 10:57:19 AM |
| InChI | InChI=1S/C17H14N2O2/c1-13-12-16(19(18-13)15-10-6-3-7-11-15)21-17(20)14-8-4-2-5-9-14/h2-12H,1H3 |
| InChI Key | YVVNCZNGWZHOGZ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN(C(=C1)OC(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Benzoic acid 5-methyl-2-phenyl-2H-pyrazol-3-yl ester |