Systematic / IUPAC Name: 1-[4,4-Bis(3-methyl-2-thienyl)-3-buten-1-yl]-3-piperidinecarboxylic acid
ID: Reference6957
Other Names:
1-[4,4-Bis(3-methylthiophen-2-yl)but-3-en-1-yl]piperidine-3-carboxylic acid;
3-Piperidinecarboxylicacid, 1-[4,4-bis(3-methyl-2-thienyl)-3-buten-1-yl]-
Formula: C20H25NO2S2
Tiagabine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 369 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/26/2017 8:11:53 AM |
| InChI | InChI=1S/C20H25NO2S2/c1-14-7-11-24-18(14)17(19-15(2)8-12-25-19)6-4-10-21-9-3-5-16(13-21)20(22)23/h6-8,11-12,16H,3-5,9-10,13H2,1-2H3,(H,22,23) |
| InChI Key | PBJUNZJWGZTSKL-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC=C1)C(=CCCN2CCCC(C2)C(=O)O)C3=C(C=CS3)C |
| CAS | |
| Splash | |
| Other Names |
1-[4,4-Bis(3-methylthiophen-2-yl)but-3-en-1-yl]piperidine-3-carboxylic acid; 3-Piperidinecarboxylicacid, 1-[4,4-bis(3-methyl-2-thienyl)-3-buten-1-yl]- |
| Wikipedia | Tiagabine |
| PubChem | 5466 |
| ChEMBL | CHEMBL1190260 |
| ChemSpider | 5267 |