Systematic / IUPAC Name: 3-Ethoxy-N'-(4-nitrobenzoyl)-2-thiophenecarbohydrazide
ID: Reference6975
Other Names: 2-Thiophenecarboxylic acid, 3-ethoxy-, 2-(4-nitrobenzoyl)hydrazide
Formula: C14H13N3O5S
N'2-(4-Nitrobenzoyl)-3-ethoxythiophene-2-carbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 122 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/20/2017 9:09:21 AM |
| InChI | InChI=1S/C14H13N3O5S/c1-2-22-11-7-8-23-12(11)14(19)16-15-13(18)9-3-5-10(6-4-9)17(20)21/h3-8H,2H2,1H3,(H,15,18)(H,16,19) |
| InChI Key | XMZVWWHXQHWVST-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxylic acid, 3-ethoxy-, 2-(4-nitrobenzoyl)hydrazide |