Systematic / IUPAC Name: 2-(1,3-Benzothiazol-2-yl)-N-carbamoylacetamide
ID: Reference6988
Other Names: 2-Benzothiazoleacetamide, N-(aminocarbonyl)-
Formula: C10H9N3O2S
N-[2-(1,3-Benzothiazol-2-yl)acetyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/20/2017 11:24:17 AM |
| InChI | InChI=1S/C10H9N3O2S/c11-10(15)13-8(14)5-9-12-6-3-1-2-4-7(6)16-9/h1-4H,5H2,(H3,11,13,14,15) |
| InChI Key | NPZYLGYIVBJZIV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)N=C(S2)CC(=O)NC(=O)N |
| CAS | |
| Splash | |
| Other Names | 2-Benzothiazoleacetamide, N-(aminocarbonyl)- |