Systematic / IUPAC Name: Benzyl 4-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-1-piperidinecarboxylate
ID: Reference6992
Other Names: 1-Piperidinecarboxylic acid, 4-{[(2,3-dihydro-1H-inden-2-yl)amino]carbonyl}-, phenylmethyl ester
Formula: C23H26N2O3
Benzyl 4-[(2,3-dihydro-1H-inden-2-ylamino)carbonyl]tetrahydro-1(2H)-pyridinecarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/20/2017 12:36:42 PM |
| InChI | InChI=1S/C23H26N2O3/c26-22(24-21-14-19-8-4-5-9-20(19)15-21)18-10-12-25(13-11-18)23(27)28-16-17-6-2-1-3-7-17/h1-9,18,21H,10-16H2,(H,24,26) |
| InChI Key | ZFIWRMAHLGYTDE-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCC1C(=O)NC2CC3=CC=CC=C3C2)C(=O)OCC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 1-Piperidinecarboxylic acid, 4-{[(2,3-dihydro-1H-inden-2-yl)amino]carbonyl}-, phenylmethyl ester |