Systematic / IUPAC Name: 1-[2-(4-Morpholinyl)phenyl]-3-phenylurea
ID: Reference6999
Other Names: Urea, N-[2-(4-morpholinyl)phenyl]-N'-phenyl-
Formula: C17H19N3O2
N-(2-Morpholinophenyl)-N'-phenylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/20/2017 1:16:44 PM |
| InChI | InChI=1S/C17H19N3O2/c21-17(18-14-6-2-1-3-7-14)19-15-8-4-5-9-16(15)20-10-12-22-13-11-20/h1-9H,10-13H2,(H2,18,19,21) |
| InChI Key | RTFCOVWMHWUGIH-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1C2=CC=CC=C2NC(=O)NC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Urea, N-[2-(4-morpholinyl)phenyl]-N'-phenyl- |