Systematic / IUPAC Name: 1-[5-Methyl-2-(trifluoromethyl)-3-furoyl]-4-piperidinecarboxylic acid
ID: Reference7002
Other Names:
1-{[5-Methyl-2-(trifluoromethyl)furan-3-yl]carbonyl}piperidine-4-carboxylic acid;
4-Piperidinecarboxylic acid, 1-{[5-methyl-2-(trifluoromethyl)-3-furanyl]carbonyl}-
Formula: C13H14F3NO4
1-{[5-Methyl-2-(trifluoromethyl)-3-furyl]carbonyl}-4-piperidinecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/20/2017 2:18:46 PM |
| InChI | InChI=1S/C13H14F3NO4/c1-7-6-9(10(21-7)13(14,15)16)11(18)17-4-2-8(3-5-17)12(19)20/h6,8H,2-5H2,1H3,(H,19,20) |
| InChI Key | BWHATOJYDWARIE-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(O1)C(F)(F)F)C(=O)N2CCC(CC2)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
1-{[5-Methyl-2-(trifluoromethyl)furan-3-yl]carbonyl}piperidine-4-carboxylic acid; 4-Piperidinecarboxylic acid, 1-{[5-methyl-2-(trifluoromethyl)-3-furanyl]carbonyl}- |
| ChEMBL | CHEMBL1733101 |
| ChemSpider | 2091837 |
| PubChem | 2813436 |