Systematic / IUPAC Name: N2-(2,3-Dihydro-1H-inden-2-yl)-N-[2-(4-morpholinyl)phenyl]glycinamide
ID: Reference7003
Other Names: Acetamide, 2-[(2,3-dihydro-1H-inden-2-yl)amino]-N-[2-(4-morpholinyl)phenyl]-
Formula: C21H25N3O2
2-(2,3-Dihydro-1H-inden-2-ylamino)-N-(2-morpholinophenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/20/2017 2:25:23 PM |
| InChI | InChI=1S/C21H25N3O2/c25-21(15-22-18-13-16-5-1-2-6-17(16)14-18)23-19-7-3-4-8-20(19)24-9-11-26-12-10-24/h1-8,18,22H,9-15H2,(H,23,25) |
| InChI Key | OPVUCAPJMUJJEM-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1C2=CC=CC=C2NC(=O)CNC3CC4=CC=CC=C4C3 |
| CAS | |
| Splash | |
| Other Names | Acetamide, 2-[(2,3-dihydro-1H-inden-2-yl)amino]-N-[2-(4-morpholinyl)phenyl]- |