Systematic / IUPAC Name: N-{(E)-2-[1-(4-Bromophenyl)-1H-tetrazol-5-yl]vinyl}-5-(2-methyl-2-propanyl)-1,2-oxazol-3-amine
ID: Reference7009
Other Names: 3-Isoxazolamine, N-{(E)-2-[1-(4-bromophenyl)-1H-tetrazol-5-yl]ethenyl}-5-(1,1-dimethylethyl)-
Formula: C16H17BrN6O
N-{2-[1-(4-Bromophenyl)-1H-1,2,3,4-tetraazol-5-yl]vinyl}-5-(tert-butyl)-3-isoxazolamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 8:37:35 AM |
| InChI | InChI=1S/C16H17BrN6O/c1-16(2,3)13-10-14(20-24-13)18-9-8-15-19-21-22-23(15)12-6-4-11(17)5-7-12/h4-10H,1-3H3,(H,18,20)/b9-8+ |
| InChI Key | RDXAJBFDEKBWFD-CMDGGOBGSA-N |
| Canonical SMILES | CC(C)(C)C1=CC(=NO1)NC=CC2=NN=NN2C3=CC=C(C=C3)Br |
| CAS | |
| Splash | |
| Other Names | 3-Isoxazolamine, N-{(E)-2-[1-(4-bromophenyl)-1H-tetrazol-5-yl]ethenyl}-5-(1,1-dimethylethyl)- |