Systematic / IUPAC Name: 4-(Tetrahydro-2-furanylcarbonyl)-N-(2-thienyl)-1-piperazinecarboxamide
ID: Reference7013
Other Names: 1-Piperazinecarboxamide, 4-[(tetrahydro-2-furanyl)carbonyl]-N-2-thienyl-
Formula: C14H19N3O3S
4-(Tetrahydro-2-furanylcarbonyl)-N-(2-thienyl)tetrahydro-1(2H)-pyrazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 8:50:09 AM |
| InChI | InChI=1S/C14H19N3O3S/c18-13(11-3-1-9-20-11)16-5-7-17(8-6-16)14(19)15-12-4-2-10-21-12/h2,4,10-11H,1,3,5-9H2,(H,15,19) |
| InChI Key | WGHQUXKPQOLJDT-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(OC1)C(=O)N2CCN(CC2)C(=O)NC3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names | 1-Piperazinecarboxamide, 4-[(tetrahydro-2-furanyl)carbonyl]-N-2-thienyl- |
| ChEBI | CHEBI:93915 |
| PubChem | 2815576 |
| ChemSpider | 2093940 |