Systematic / IUPAC Name: N-(3-Cyano-4,5-dimethyl-2-thienyl)-2-(4-phenyl-1-piperazinyl)acetamide
ID: Reference7018
Other Names: N-(3-Cyano-4,5-dimethylthiophen-2-yl)-2-(4-phenylpiperazin-1-yl)acetamide
Formula: C19H22N4OS
N-(3-Cyano-4,5-dimethyl-2-thienyl)-2-(4-phenylpiperazino)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 209 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 9:07:45 AM |
| InChI | InChI=1S/C19H22N4OS/c1-14-15(2)25-19(17(14)12-20)21-18(24)13-22-8-10-23(11-9-22)16-6-4-3-5-7-16/h3-7H,8-11,13H2,1-2H3,(H,21,24) |
| InChI Key | GIRVTXIFVKXQLR-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC(=C1C#N)NC(=O)CN2CCN(CC2)C3=CC=CC=C3)C |
| CAS | |
| Splash | |
| Other Names | N-(3-Cyano-4,5-dimethylthiophen-2-yl)-2-(4-phenylpiperazin-1-yl)acetamide |