Systematic / IUPAC Name: N-(4-Bromophenyl)-4,5-dioxo-2-phenyl-4,5-dihydro-1H-pyrrole-3-carboxamide
ID: Reference7024
Other Names: 1H-Pyrrole-3-carboxamide, N-(4-bromophenyl)-4,5-dihydro-4,5-dioxo-2-phenyl-
Formula: C17H11BrN2O3
N3-(4-Bromophenyl)-4,5-dioxo-2-phenyl-4,5-dihydro-1H-pyrrole-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 91 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 9:30:54 AM |
| InChI | InChI=1S/C17H11BrN2O3/c18-11-6-8-12(9-7-11)19-16(22)13-14(20-17(23)15(13)21)10-4-2-1-3-5-10/h1-9H,(H,19,22)(H,20,21,23) |
| InChI Key | ZDBVWVWAEDXEOX-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(C(=O)C(=O)N2)C(=O)NC3=CC=C(C=C3)Br |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrrole-3-carboxamide, N-(4-bromophenyl)-4,5-dihydro-4,5-dioxo-2-phenyl- |