Systematic / IUPAC Name: 2,2'-{1,4-Cyclohexanediylbis[methylenenitrilo(E)methylylidene]}diphenol
ID: Reference7029
Other Names: Phenol, 2,2'-[1,4-cyclohexanediylbis(methylenenitrilomethylidyne)]bis-
Formula: C22H26N2O2
2-[({[4-({[(2-hydroxyphenyl)methylene]amino}methyl)cyclohexyl]methyl}imino)methyl]phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 9:44:25 AM |
| InChI | InChI=1S/C22H26N2O2/c25-21-7-3-1-5-19(21)15-23-13-17-9-11-18(12-10-17)14-24-16-20-6-2-4-8-22(20)26/h1-8,15-18,25-26H,9-14H2/b23-15+,24-16+ |
| InChI Key | IQUQYVNGKZBPPJ-DFEHQXHXSA-N |
| Canonical SMILES | c1cc(c(cc1)O)/C=N/CC2CCC(CC2)C/N=C/c3c(cccc3)O |
| CAS | |
| Splash | |
| Other Names | Phenol, 2,2'-[1,4-cyclohexanediylbis(methylenenitrilomethylidyne)]bis- |