Systematic / IUPAC Name: (2E)-2-(2-Thienylcarbonyl)-3-{[4-(trifluoromethoxy)phenyl]amino}acrylonitrile
ID: Reference7039
Other Names: (E)-2-(Thiophene-2-carbonyl)-3-[4-(trifluoromethoxy)anilino]prop-2-enenitrile
Formula: C15H9F3N2O2S
2-(2-Thienylcarbonyl)-3-[4-(trifluoromethoxy)anilino]acrylonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 91 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 12:35:24 PM |
| InChI | InChI=1S/C15H9F3N2O2S/c16-15(17,18)22-12-5-3-11(4-6-12)20-9-10(8-19)14(21)13-2-1-7-23-13/h1-7,9,20H/b10-9+ |
| InChI Key | QTPRZYIEJOCKKZ-MDZDMXLPSA-N |
| Canonical SMILES | C1=CSC(=C1)C(=O)C(=CNC2=CC=C(C=C2)OC(F)(F)F)C#N |
| CAS | |
| Splash | |
| Other Names | (E)-2-(Thiophene-2-carbonyl)-3-[4-(trifluoromethoxy)anilino]prop-2-enenitrile |