Systematic / IUPAC Name: 2,3-Dichloro-N-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylideneamino]benzamide
ID: Reference7043
Other Names:
Formula: C19H18Cl2N2O2
N'1-[(2,2-Dimethyl-3,4-dihydro-2H-chromen-6-yl)methylidene]-2,3-dichlorobenzene-1-carbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 12:47:54 PM |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-19(2)9-8-13-10-12(6-7-16(13)25-19)11-22-23-18(24)14-4-3-5-15(20)17(14)21/h3-7,10-11H,8-9H2,1-2H3,(H,23,24) |
| InChI Key | MEPKSOBJBOVASZ-UHFFFAOYSA-N |
| Canonical SMILES | CC1(CCC2=C(O1)C=CC(=C2)C=NNC(=O)C3=C(C(=CC=C3)Cl)Cl)C |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 2821001 |