Systematic / IUPAC Name: 1,3-Dithiepan-2-ylidene(phenylsulfonyl)acetonitrile
ID: Reference7044
Other Names: Acetonitrile, 2-(1,3-dithiepan-2-ylidene)-2-(phenylsulfonyl)-
Formula: C13H13NO2S3
2-(1,3-Dithiepan-2-yliden)-2-(phenylsulfonyl)acetonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 182 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 12:49:49 PM |
| InChI | InChI=1S/C13H13NO2S3/c14-10-12(13-17-8-4-5-9-18-13)19(15,16)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-9H2 |
| InChI Key | CUPHSJZFOJQLMX-UHFFFAOYSA-N |
| Canonical SMILES | C1CCSC(=C(C#N)S(=O)(=O)C2=CC=CC=C2)SC1 |
| CAS | |
| Splash | |
| Other Names | Acetonitrile, 2-(1,3-dithiepan-2-ylidene)-2-(phenylsulfonyl)- |