Systematic / IUPAC Name: 1-Benzyl-3-[(E)-(benzylimino)(2-furyl)methyl]-6-(2-furyl)-1,3,5-triazine-2,4(1H,3H)-dithione
ID: Reference7058
Other Names: 1,3,5-Triazine-2,4(1H,3H)-dithione, 6-(2-furanyl)-3-[(E)-2-furanyl[(phenylmethyl)imino]methyl]-1-(phenylmethyl)-
Formula: C26H20N4O2S2
1-Benzyl-3-[(benzylimino)(2-furyl)methyl]-6-(2-furyl)-1,2,3,4-tetrahydro-1,3,5-triazine-2,4-dithione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 12:57:41 PM |
| InChI | InChI=1S/C26H20N4O2S2/c33-25-28-24(22-14-8-16-32-22)29(18-20-11-5-2-6-12-20)26(34)30(25)23(21-13-7-15-31-21)27-17-19-9-3-1-4-10-19/h1-16H,17-18H2/b27-23+ |
| InChI Key | OWGBJISPDZNHMF-SLEBQGDGSA-N |
| Canonical SMILES | c1ccc(cc1)C/N=C(\c2ccco2)/n3c(=S)nc(n(c3=S)Cc4ccccc4)c5ccco5 |
| CAS | |
| Splash | |
| Other Names | 1,3,5-Triazine-2,4(1H,3H)-dithione, 6-(2-furanyl)-3-[(E)-2-furanyl[(phenylmethyl)imino]methyl]-1-(phenylmethyl)- |