Systematic / IUPAC Name: 4-[(2,6-Dichlorobenzyl)sulfanyl]pyrrolo[1,2-a]quinoxaline
ID: Reference7063
Other Names: 4-[(2,6-Dichlorophenyl)methylsulfanyl]pyrrolo[1,2-a]quinoxaline
Formula: C18H12Cl2N2S
4-[(2,6-Dichlorobenzyl)thio]pyrrolo[1,2-a]quinoxaline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/22/2017 9:21:01 AM |
| InChI | InChI=1S/C18H12Cl2N2S/c19-13-5-3-6-14(20)12(13)11-23-18-17-9-4-10-22(17)16-8-2-1-7-15(16)21-18/h1-10H,11H2 |
| InChI Key | FQGSVAGPNWFPJO-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)N=C(C3=CC=CN23)SCC4=C(C=CC=C4Cl)Cl |
| CAS | |
| Splash | |
| Other Names | 4-[(2,6-Dichlorophenyl)methylsulfanyl]pyrrolo[1,2-a]quinoxaline |