Systematic / IUPAC Name: (3Z)-3-(Dibenzo[b,e]oxepin-11(6H)-ylidene)-N,N-dimethyl-1-propanamine
ID: Reference707
Other Names: 1-Propanamine, 3-dibenz[b,e]oxepin-11(6H)-ylidene-N,N-dimethyl-
Formula: C19H21NO
Class: Therapeutics/Prescription Drugs
Doxepin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 261 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/25/2015 12:14:01 PM |
| InChI | InChI=1S/C19H21NO/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3 |
| InChI Key | ODQWQRRAPPTVAG-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 1668195 |
| Splash | |
| Other Names | 1-Propanamine, 3-dibenz[b,e]oxepin-11(6H)-ylidene-N,N-dimethyl- |
| HMDb | HMDB15273 |
| PubChem | 3158 |
| KEGG | C06971 |
| ChEMBL | CHEMBL1628227 |
| ChEBI | CHEBI:4710 |
| Wikipedia | Doxepin |
| ChemSpider | 3046 |