Systematic / IUPAC Name: 2,4-Dichloro-N-(3-pyridinylmethyl)aniline
ID: Reference7071
Other Names:
2,4-Dichloro-N-(pyridin-3-ylmethyl)aniline;
3-Pyridinemethanamine, N-(2,4-dichlorophenyl)-
Formula: C12H10Cl2N2
N1-(3-Pyridylmethyl)-2,4-dichloroaniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/23/2017 9:42:38 AM |
| InChI | InChI=1S/C12H10Cl2N2/c13-10-3-4-12(11(14)6-10)16-8-9-2-1-5-15-7-9/h1-7,16H,8H2 |
| InChI Key | HNQDMSRGKGZQMN-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CN=C1)CNC2=C(C=C(C=C2)Cl)Cl |
| CAS | |
| Splash | |
| Other Names |
2,4-Dichloro-N-(pyridin-3-ylmethyl)aniline; 3-Pyridinemethanamine, N-(2,4-dichlorophenyl)- |
| ChemSpider | 2083060 |
| ChEMBL | CHEMBL1456288 |
| PubChem | 2804511 |