Systematic / IUPAC Name: N-(2,3-Dihydro-1H-indol-1-ylcarbonothioyl)-5-(phenylethynyl)nicotinamide
ID: Reference7074
Other Names: 3-Pyridinecarboxamide, N-[(2,3-dihydro-1H-indol-1-yl)thioxomethyl]-5-(2-phenylethynyl)-
Formula: C23H17N3OS
N-(2,3-Dihydro-1H-indol-1-ylcarbothioyl)-5-(2-phenylethynyl)nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/23/2017 2:25:46 PM |
| InChI | InChI=1S/C23H17N3OS/c27-22(25-23(28)26-13-12-19-8-4-5-9-21(19)26)20-14-18(15-24-16-20)11-10-17-6-2-1-3-7-17/h1-9,14-16H,12-13H2,(H,25,27,28) |
| InChI Key | ATGDVLZIMVZXBD-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(C2=CC=CC=C21)C(=S)NC(=O)C3=CN=CC(=C3)C#CC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarboxamide, N-[(2,3-dihydro-1H-indol-1-yl)thioxomethyl]-5-(2-phenylethynyl)- |