Systematic / IUPAC Name: N-Benzyl-2-isopropylidenehydrazinecarboxamide
ID: Reference7078
Other Names: Hydrazinecarboxamide, 2-(1-methylethylidene)-N-(phenylmethyl)-
Formula: C11H15N3O
N1-Benzyl-2-(1-methylethylidene)hydrazine-1-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/24/2017 9:37:01 AM |
| InChI | InChI=1S/C11H15N3O/c1-9(2)13-14-11(15)12-8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H2,12,14,15) |
| InChI Key | RIBQMWQHRBZVMP-UHFFFAOYSA-N |
| Canonical SMILES | CC(=NNC(=O)NCC1=CC=CC=C1)C |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarboxamide, 2-(1-methylethylidene)-N-(phenylmethyl)- |