Systematic / IUPAC Name: 1,3-Bis[(E)-[(E)-but-2-enylidene]amino]urea
ID: Reference7084
Other Names: Carbonic dihydrazide, N'',N'''-di-(1E,2E)-2-buten-1-ylidene-
Formula: C9H14N4O
N'',N'''-Dibut-2-enylidenecarbonic dihydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/27/2017 8:48:53 AM |
| InChI | InChI=1S/C9H14N4O/c1-3-5-7-10-12-9(14)13-11-8-6-4-2/h3-8H,1-2H3,(H2,12,13,14)/b5-3+,6-4+,10-7+,11-8+ |
| InChI Key | HPRSHVDHVRKXRU-FPTHMUSISA-N |
| Canonical SMILES | CC=CC=NNC(=O)NN=CC=CC |
| CAS | |
| Splash | |
| Other Names | Carbonic dihydrazide, N'',N'''-di-(1E,2E)-2-buten-1-ylidene- |