Systematic / IUPAC Name: N'-(2,5-Dichlorophenyl)tetrahydro-2-thiophenecarbohydrazide
ID: Reference7090
Other Names: 2-Thiophenecarboxylic acid, tetrahydro-, 2-(2,5-dichlorophenyl)hydrazide
Formula: C11H12Cl2N2OS
N'2-(2,5-Dichlorophenyl)tetrahydrothiophene-2-carbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 85 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/27/2017 12:23:08 PM |
| InChI | InChI=1S/C11H12Cl2N2OS/c12-7-3-4-8(13)9(6-7)14-15-11(16)10-2-1-5-17-10/h3-4,6,10,14H,1-2,5H2,(H,15,16) |
| InChI Key | TYJVXBISTXIYQO-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(SC1)C(=O)NNC2=C(C=CC(=C2)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxylic acid, tetrahydro-, 2-(2,5-dichlorophenyl)hydrazide |