Systematic / IUPAC Name: (2,4-Dichlorophenyl){[(E)-6,7-dihydro-1-benzofuran-4(5H)-ylideneamino]oxy}methanone
ID: Reference7095
Other Names: 4(5H)-Benzofuranone, 6,7-dihydro, O-(2,4-dichlorobenzoyl)oxime, (4E)-
Formula: C15H11Cl2NO3
4-{[(2,4-Dichlorobenzoyl)oxy]imino}-4,5,6,7-tetrahydro-1-benzofuran mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 107 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/28/2017 9:29:14 AM |
| InChI | InChI=1S/C15H11Cl2NO3/c16-9-4-5-10(12(17)8-9)15(19)21-18-13-2-1-3-14-11(13)6-7-20-14/h4-8H,1-3H2/b18-13+ |
| InChI Key | BWSJXFPGAQJCJD-QGOAFFKASA-N |
| Canonical SMILES | C1CC2=C(C=CO2)C(=NOC(=O)C3=C(C=C(C=C3)Cl)Cl)C1 |
| CAS | |
| Splash | |
| Other Names | 4(5H)-Benzofuranone, 6,7-dihydro, O-(2,4-dichlorobenzoyl)oxime, (4E)- |