Systematic / IUPAC Name: Ethyl (2Z)-2-cyano-3-[(2-ethoxy-2-oxoethyl)sulfanyl]-3-{[2-(trifluoromethyl)phenyl]amino}acrylate
ID: Reference7102
Other Names: 2-Propenoic acid, 2-cyano-3-[(2-ethoxy-2-oxoethyl)thio]-3-{[2-(trifluoromethyl)phenyl]amino}-, ethyl ester, (2Z)-
Formula: C17H17F3N2O4S
Ethyl 2-cyano-3-[(2-ethoxy-2-oxoethyl)sulfanyl]-3-[2-(trifluoromethyl)anilino]acrylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 91 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/29/2017 8:02:02 AM |
| InChI | InChI=1S/C17H17F3N2O4S/c1-3-25-14(23)10-27-15(11(9-21)16(24)26-4-2)22-13-8-6-5-7-12(13)17(18,19)20/h5-8,22H,3-4,10H2,1-2H3/b15-11- |
| InChI Key | JKXBZCRFARDOEK-PTNGSMBKSA-N |
| Canonical SMILES | CCOC(=O)CSC(=C(C#N)C(=O)OCC)NC1=CC=CC=C1C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 2-Propenoic acid, 2-cyano-3-[(2-ethoxy-2-oxoethyl)thio]-3-{[2-(trifluoromethyl)phenyl]amino}-, ethyl ester, (2Z)- |