Systematic / IUPAC Name: 2-Phenyl-N,N-bis(2-pyridinylmethyl)-1,3-thiazole-4-carboxamide
ID: Reference7122
Other Names: 4-Thiazolecarboxamide, 2-phenyl-N,N-bis(2-pyridinylmethyl)-
Formula: C22H18N4OS
2-Phenyl-N,N-bis(2-pyridinylmethyl)-1,3-thiazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/1/2017 2:26:31 PM |
| InChI | InChI=1S/C22H18N4OS/c27-22(20-16-28-21(25-20)17-8-2-1-3-9-17)26(14-18-10-4-6-12-23-18)15-19-11-5-7-13-24-19/h1-13,16H,14-15H2 |
| InChI Key | SBCMIYBIOAPBLD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=NC(=CS2)C(=O)N(CC3=CC=CC=N3)CC4=CC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | 4-Thiazolecarboxamide, 2-phenyl-N,N-bis(2-pyridinylmethyl)- |