Systematic / IUPAC Name: 2,2'-(Methylenedisulfanediyl)bis(N-benzylacetamide)
ID: Reference7127
Other Names:
N-Benzyl-2-{[2-(benzylamino)-2-oxoethyl]sulfanylmethylsulfanyl}acetamide ;
Acetamide, 2,2'-[methylenebis(thio)]bis[N-(phenylmethyl)-
Formula: C19H22N2O2S2
N-Benzyl-2-[({[2-(benzylamino)-2-oxoethyl]thio}methyl)thio]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2017 1:50:14 PM |
| InChI | InChI=1S/C19H22N2O2S2/c22-18(20-11-16-7-3-1-4-8-16)13-24-15-25-14-19(23)21-12-17-9-5-2-6-10-17/h1-10H,11-15H2,(H,20,22)(H,21,23) |
| InChI Key | QFBIXDIZMZNXKZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CNC(=O)CSCSCC(=O)NCC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
N-Benzyl-2-{[2-(benzylamino)-2-oxoethyl]sulfanylmethylsulfanyl}acetamide ; Acetamide, 2,2'-[methylenebis(thio)]bis[N-(phenylmethyl)- |